About 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol
2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol (PubChem CID 16746417) has the molecular formula C23H32N2O3
and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol.
Molecular Properties
| Compound Name | 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol |
| PubChem CID | 16746417 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(C(CCN2CCCC2)c2ccc(N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H32N2O3/c1-24(2)18-9-7-17(8-10-18)20(11-14-25-12-5-6-13-25)23-21(26)15-19(27-3)16-22(23)28-4/h7-10,15-16,20,26H,5-6,11-14H2,1-4H3 |
| InChIKey | CBKINESZAJBQJQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol?
The IUPAC name of 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol (CID 16746417) is 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol.
What is the SMILES notation for 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol?
The canonical SMILES for 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol is COc1cc(O)c(C(CCN2CCCC2)c2ccc(N(C)C)cc2)c(OC)c1.
What is the InChIKey of 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol?
The InChIKey is CBKINESZAJBQJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O3/c1-24(2)18-9-7-17(8-10-18)20(11-14-25-12-5-6-13-25)23-21(26)15-19(27-3)16-22(23)28-4/h7-10,15-16,20,26H,5-6,11-14H2,1-4H3.
What are the key properties of 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol?
2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol has a molecular weight of 384.52 g/mol, XLogP of 4.09, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-(dimethylamino)phenyl]-3-pyrrolidin-1-ylpropyl]-3,5-dimethoxyphenol is sourced from PubChem (CID 16746417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).