C33H31NO2 — CID 16746421
(3R,3aS,7R,7aS)-2-benzyl-3-[1-(4-methoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746421) has the molecular formula C33H31NO2 and a molecular weight of 473.62 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-3-[1-(4-methoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-3-[1-(4-methoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746421 |
| Molecular Formula | C33H31NO2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-3-[1-(4-methoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | COc1ccc(-c2c([C@H]3[C@H]4C=CC[C@@H](C)[C@@H]4C(=O)N3Cc3ccccc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C33H31NO2/c1-22-9-8-14-28-30(22)33(35)34(21-23-10-4-3-5-11-23)32(28)29-20-17-24-12-6-7-13-27(24)31(29)25-15-18-26(36-2)19-16-25/h3-8,10-20,22,28,30,32H,9,21H2,1-2H3/t22-,28+,30+,32-/m1/s1 |
| InChIKey | QZYZYZGGQGJXMN-MVXLQIMRSA-N |
| XLogP | 7.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|