C24H24F3NO — CID 16746426
(3R,3aS,7R,7aS)-2-benzyl-7-ethyl-3-[4-(trifluoromethyl)phenyl]-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746426) has the molecular formula C24H24F3NO and a molecular weight of 399.46 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-7-ethyl-3-[4-(trifluoromethyl)phenyl]-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-7-ethyl-3-[4-(trifluoromethyl)phenyl]-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746426 |
| Molecular Formula | C24H24F3NO |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-7-ethyl-3-[4-(trifluoromethyl)phenyl]-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CC[C@@H]1CC=C[C@H]2[C@H]1C(=O)N(Cc1ccccc1)[C@H]2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3NO/c1-2-17-9-6-10-20-21(17)23(29)28(15-16-7-4-3-5-8-16)22(20)18-11-13-19(14-12-18)24(25,26)27/h3-8,10-14,17,20-22H,2,9,15H2,1H3/t17-,20+,21+,22+/m1/s1 |
| InChIKey | ZJEILNFETXCMAH-MNAPGUCWSA-N |
| XLogP | 6.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|