About 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide
3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide (PubChem CID 16746431) has the molecular formula C23H32N2O4
and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide.
Molecular Properties
| Compound Name | 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide |
| PubChem CID | 16746431 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide |
| SMILES | CCN(CC)C(=O)CC(c1ccc(N(C)C)cc1)c1c(O)cc(OC)cc1OC |
| InChI | InChI=1S/C23H32N2O4/c1-7-25(8-2)22(27)15-19(16-9-11-17(12-10-16)24(3)4)23-20(26)13-18(28-5)14-21(23)29-6/h9-14,19,26H,7-8,15H2,1-6H3 |
| InChIKey | NDGGXDTVNFALMI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide?
The IUPAC name of 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide (CID 16746431) is 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide.
What is the SMILES notation for 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide?
The canonical SMILES for 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide is CCN(CC)C(=O)CC(c1ccc(N(C)C)cc1)c1c(O)cc(OC)cc1OC.
What is the InChIKey of 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide?
The InChIKey is NDGGXDTVNFALMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O4/c1-7-25(8-2)22(27)15-19(16-9-11-17(12-10-16)24(3)4)23-20(26)13-18(28-5)14-21(23)29-6/h9-14,19,26H,7-8,15H2,1-6H3.
What are the key properties of 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide?
3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide has a molecular weight of 400.52 g/mol, XLogP of 3.87, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(dimethylamino)phenyl]-N,N-diethyl-3-(2-hydroxy-4,6-dimethoxyphenyl)propanamide is sourced from PubChem (CID 16746431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).