C29H26FN3O4S — CID 16746453
(6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-quinolin-8-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one (PubChem CID 16746453) has the molecular formula C29H26FN3O4S and a molecular weight of 531.61 g/mol. Its IUPAC name is (6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-quinolin-8-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one.
| Compound Name | (6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-quinolin-8-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one |
|---|---|
| PubChem CID | 16746453 |
| Molecular Formula | C29H26FN3O4S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-quinolin-8-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one |
| SMILES | COc1ccc(C2/C=C\CN(S(=O)(=O)c3cccc4cccnc34)CC(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H26FN3O4S/c1-37-25-15-11-22(12-16-25)26-7-4-18-32(20-28(34)33(26)19-21-9-13-24(30)14-10-21)38(35,36)27-8-2-5-23-6-3-17-31-29(23)27/h2-17,26H,18-20H2,1H3/b7-4- |
| InChIKey | IDMOJNNXCRNSRZ-DAXSKMNVSA-N |
| XLogP | 4.71 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|