About 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one
4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one (PubChem CID 16746458) has the molecular formula C22H27BrN2OS
and a molecular weight of 447.44 g/mol. Its IUPAC name is 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one |
| PubChem CID | 16746458 |
| Molecular Formula | C22H27BrN2OS |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one |
| SMILES | CCCN1CCC(=O)N([C@H](CSc2ccc(Br)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27BrN2OS/c1-2-13-24-14-12-22(26)25(16-15-24)21(18-6-4-3-5-7-18)17-27-20-10-8-19(23)9-11-20/h3-11,21H,2,12-17H2,1H3/t21-/m1/s1 |
| InChIKey | OZCKZSBDMAXLIS-OAQYLSRUSA-N |
| XLogP | 5.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one?
The IUPAC name of 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one (CID 16746458) is 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one.
What is the SMILES notation for 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one?
The canonical SMILES for 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one is CCCN1CCC(=O)N([C@H](CSc2ccc(Br)cc2)c2ccccc2)CC1.
What is the InChIKey of 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one?
The InChIKey is OZCKZSBDMAXLIS-OAQYLSRUSA-N. The full InChI is InChI=1S/C22H27BrN2OS/c1-2-13-24-14-12-22(26)25(16-15-24)21(18-6-4-3-5-7-18)17-27-20-10-8-19(23)9-11-20/h3-11,21H,2,12-17H2,1H3/t21-/m1/s1.
What are the key properties of 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one?
4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one has a molecular weight of 447.44 g/mol, XLogP of 5.23, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-2-(4-bromophenyl)sulfanyl-1-phenylethyl]-1-propyl-1,4-diazepan-5-one is sourced from PubChem (CID 16746458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).