C19H28N2O2S — CID 167465092
(5Z)-5-[5,5-dimethyl-3-[(E)-prop-1-enyl]cyclohex-2-en-1-ylidene]-1,3-diethyl-6-hydroxy-2-sulfanylidene-1,3-diazinan-4-one (PubChem CID 167465092) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is (5Z)-5-[5,5-dimethyl-3-[(E)-prop-1-enyl]cyclohex-2-en-1-ylidene]-1,3-diethyl-6-hydroxy-2-sulfanylidene-1,3-diazinan-4-one.
| Compound Name | (5Z)-5-[5,5-dimethyl-3-[(E)-prop-1-enyl]cyclohex-2-en-1-ylidene]-1,3-diethyl-6-hydroxy-2-sulfanylidene-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 167465092 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (5Z)-5-[5,5-dimethyl-3-[(E)-prop-1-enyl]cyclohex-2-en-1-ylidene]-1,3-diethyl-6-hydroxy-2-sulfanylidene-1,3-diazinan-4-one |
| SMILES | C/C=C/C1=C/C(=C2\C(=O)N(CC)C(=S)N(CC)C2O)CC(C)(C)C1 |
| InChI | InChI=1S/C19H28N2O2S/c1-6-9-13-10-14(12-19(4,5)11-13)15-16(22)20(7-2)18(24)21(8-3)17(15)23/h6,9-10,16,22H,7-8,11-12H2,1-5H3/b9-6+,15-14+ |
| InChIKey | YEIJCPYSGZHZOI-NUFNZXCZSA-N |
| XLogP | 3.39 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|