About 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide
2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide (PubChem CID 16746524) has the molecular formula C24H23NO3S
and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide |
| PubChem CID | 16746524 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide |
| SMILES | C=C1c2ccccc2S(=O)(=O)N(Cc2ccccc2)C1COCc1ccccc1 |
| InChI | InChI=1S/C24H23NO3S/c1-19-22-14-8-9-15-24(22)29(26,27)25(16-20-10-4-2-5-11-20)23(19)18-28-17-21-12-6-3-7-13-21/h2-15,23H,1,16-18H2 |
| InChIKey | XCICRGGYNTXSOT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide?
The IUPAC name of 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide (CID 16746524) is 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide.
What is the SMILES notation for 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide?
The canonical SMILES for 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide is C=C1c2ccccc2S(=O)(=O)N(Cc2ccccc2)C1COCc1ccccc1.
What is the InChIKey of 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide?
The InChIKey is XCICRGGYNTXSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3S/c1-19-22-14-8-9-15-24(22)29(26,27)25(16-20-10-4-2-5-11-20)23(19)18-28-17-21-12-6-3-7-13-21/h2-15,23H,1,16-18H2.
What are the key properties of 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide?
2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide has a molecular weight of 405.52 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-methylidene-3-(phenylmethoxymethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide is sourced from PubChem (CID 16746524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).