C11H19NO — CID 167466770
5-but-2-enyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 167466770) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-but-2-enyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | 5-but-2-enyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 167466770 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 5-but-2-enyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | CC=CCN1CCC2OCCC2C1 |
| InChI | InChI=1S/C11H19NO/c1-2-3-6-12-7-4-11-10(9-12)5-8-13-11/h2-3,10-11H,4-9H2,1H3 |
| InChIKey | XHMKTQWYJZPCSL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|