C25H26N6O2 — CID 167467170
2-[6-amino-5-[8-[2-(4-hydroxybut-1-ynyl)-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol (PubChem CID 167467170) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[6-amino-5-[8-[2-(4-hydroxybut-1-ynyl)-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[8-[2-(4-hydroxybut-1-ynyl)-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 167467170 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[6-amino-5-[8-[2-(4-hydroxybut-1-ynyl)-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1N1CC2CCC(C1)N2c1ccnc(C#CCCO)c1 |
| InChI | InChI=1S/C25H26N6O2/c26-25-23(14-22(28-29-25)21-6-1-2-7-24(21)33)30-15-19-8-9-20(16-30)31(19)18-10-11-27-17(13-18)5-3-4-12-32/h1-2,6-7,10-11,13-14,19-20,32-33H,4,8-9,12,15-16H2,(H2,26,29) |
| InChIKey | BKXLLKOJQLHDRR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|