C25H27F3N2 — CID 167467934
N-[1-(3-ethylcyclobutyl)ethenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-indol-3-amine (PubChem CID 167467934) has the molecular formula C25H27F3N2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[1-(3-ethylcyclobutyl)ethenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-indol-3-amine.
| Compound Name | N-[1-(3-ethylcyclobutyl)ethenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-indol-3-amine |
|---|---|
| PubChem CID | 167467934 |
| Molecular Formula | C25H27F3N2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[1-(3-ethylcyclobutyl)ethenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-indol-3-amine |
| SMILES | C=C(Nc1c[nH]c2ccc(CCc3ccc(C(F)(F)F)cc3)cc12)C1CC(CC)C1 |
| InChI | InChI=1S/C25H27F3N2/c1-3-17-12-20(13-17)16(2)30-24-15-29-23-11-8-19(14-22(23)24)5-4-18-6-9-21(10-7-18)25(26,27)28/h6-11,14-15,17,20,29-30H,2-5,12-13H2,1H3 |
| InChIKey | LFFDVRFLTYCIJY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |