About 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane
4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane (PubChem CID 167468398) has the molecular formula C13H14ClFN4OS
and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane |
| PubChem CID | 167468398 |
| Molecular Formula | C13H14ClFN4OS |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane |
| SMILES | CSc1nc(N2CCCOCC2)c2cnc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C13H14ClFN4OS/c1-21-13-17-10-8(7-16-11(14)9(10)15)12(18-13)19-3-2-5-20-6-4-19/h7H,2-6H2,1H3 |
| InChIKey | BKINRMFBFDJZFN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
The IUPAC name of 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane (CID 167468398) is 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane.
What is the SMILES notation for 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
The canonical SMILES for 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane is CSc1nc(N2CCCOCC2)c2cnc(Cl)c(F)c2n1.
What is the InChIKey of 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
The InChIKey is BKINRMFBFDJZFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClFN4OS/c1-21-13-17-10-8(7-16-11(14)9(10)15)12(18-13)19-3-2-5-20-6-4-19/h7H,2-6H2,1H3.
What are the key properties of 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane?
4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane has a molecular weight of 328.80 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-chloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane is sourced from PubChem (CID 167468398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).