About (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine
(4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine (PubChem CID 167468661) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine |
| PubChem CID | 167468661 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine |
| SMILES | CCC1(C)C[C@@H](F)CN1C |
| InChI | InChI=1S/C8H16FN/c1-4-8(2)5-7(9)6-10(8)3/h7H,4-6H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | DKTQGEJBZGLZOI-GVHYBUMESA-N |
| XLogP | 1.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine?
The IUPAC name of (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine (CID 167468661) is (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine.
What is the SMILES notation for (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine?
The canonical SMILES for (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine is CCC1(C)C[C@@H](F)CN1C.
What is the InChIKey of (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine?
The InChIKey is DKTQGEJBZGLZOI-GVHYBUMESA-N. The full InChI is InChI=1S/C8H16FN/c1-4-8(2)5-7(9)6-10(8)3/h7H,4-6H2,1-3H3/t7-,8?/m1/s1.
What are the key properties of (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine?
(4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine has a molecular weight of 145.22 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-ethyl-4-fluoro-1,2-dimethylpyrrolidine is sourced from PubChem (CID 167468661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).