About (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol
(3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol (PubChem CID 167468737) has the molecular formula C13H13ClF2N4O
and a molecular weight of 314.72 g/mol. Its IUPAC name is (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol |
| PubChem CID | 167468737 |
| Molecular Formula | C13H13ClF2N4O |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol |
| SMILES | C[C@@]1(O)CCCN(c2nc(F)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C13H13ClF2N4O/c1-13(21)3-2-4-20(6-13)11-7-5-17-10(14)8(15)9(7)18-12(16)19-11/h5,21H,2-4,6H2,1H3/t13-/m1/s1 |
| InChIKey | WEXHCZGAKKUUTL-CYBMUJFWSA-N |
| XLogP | 2.31 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol?
The IUPAC name of (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol (CID 167468737) is (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol.
What is the SMILES notation for (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol?
The canonical SMILES for (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol is C[C@@]1(O)CCCN(c2nc(F)nc3c(F)c(Cl)ncc23)C1.
What is the InChIKey of (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol?
The InChIKey is WEXHCZGAKKUUTL-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H13ClF2N4O/c1-13(21)3-2-4-20(6-13)11-7-5-17-10(14)8(15)9(7)18-12(16)19-11/h5,21H,2-4,6H2,1H3/t13-/m1/s1.
What are the key properties of (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol?
(3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol has a molecular weight of 314.72 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol is sourced from PubChem (CID 167468737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).