C17H23BrO2 — CID 167468968
(4-bromo-5-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl) 2,2-dimethylpropanoate (PubChem CID 167468968) has the molecular formula C17H23BrO2 and a molecular weight of 339.27 g/mol. Its IUPAC name is (4-bromo-5-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-bromo-5-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167468968 |
| Molecular Formula | C17H23BrO2 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (4-bromo-5-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl) 2,2-dimethylpropanoate |
| SMILES | CCC1CCCc2cc(OC(=O)C(C)(C)C)cc(Br)c21 |
| InChI | InChI=1S/C17H23BrO2/c1-5-11-7-6-8-12-9-13(10-14(18)15(11)12)20-16(19)17(2,3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | IJBYPDNUXOXGAG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|