About [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate
[1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate (PubChem CID 167469253) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate.
Molecular Properties
| Compound Name | [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate |
| PubChem CID | 167469253 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate |
| SMILES | CCn1cc(CCNC)c2c(OC(C)=O)ccnc21 |
| InChI | InChI=1S/C14H19N3O2/c1-4-17-9-11(5-7-15-3)13-12(19-10(2)18)6-8-16-14(13)17/h6,8-9,15H,4-5,7H2,1-3H3 |
| InChIKey | OBJXABJRHSVTQK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate?
The IUPAC name of [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate (CID 167469253) is [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate.
What is the SMILES notation for [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate?
The canonical SMILES for [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate is CCn1cc(CCNC)c2c(OC(C)=O)ccnc21.
What is the InChIKey of [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate?
The InChIKey is OBJXABJRHSVTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-4-17-9-11(5-7-15-3)13-12(19-10(2)18)6-8-16-14(13)17/h6,8-9,15H,4-5,7H2,1-3H3.
What are the key properties of [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate?
[1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate has a molecular weight of 261.32 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-ethyl-3-[2-(methylamino)ethyl]pyrrolo[2,3-b]pyridin-4-yl] acetate is sourced from PubChem (CID 167469253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).