C14H10Cl3N3O4 — CID 167469608
2-methoxyethyl N-[4-cyano-2-(2,3,5-trichlorophenyl)-1,3-oxazol-5-yl]carbamate (PubChem CID 167469608) has the molecular formula C14H10Cl3N3O4 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-cyano-2-(2,3,5-trichlorophenyl)-1,3-oxazol-5-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-cyano-2-(2,3,5-trichlorophenyl)-1,3-oxazol-5-yl]carbamate |
|---|---|
| PubChem CID | 167469608 |
| Molecular Formula | C14H10Cl3N3O4 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 2-methoxyethyl N-[4-cyano-2-(2,3,5-trichlorophenyl)-1,3-oxazol-5-yl]carbamate |
| SMILES | COCCOC(=O)Nc1oc(-c2cc(Cl)cc(Cl)c2Cl)nc1C#N |
| InChI | InChI=1S/C14H10Cl3N3O4/c1-22-2-3-23-14(21)20-13-10(6-18)19-12(24-13)8-4-7(15)5-9(16)11(8)17/h4-5H,2-3H2,1H3,(H,20,21) |
| InChIKey | CWECHHBUFXCGQA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|