C16H23N3O — CID 167469898
ethane;3-[1-ethenyl-5-[(Z)-prop-1-enyl]pyrazol-4-yl]-6-methylidenepiperidin-2-one (PubChem CID 167469898) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is ethane;3-[1-ethenyl-5-[(Z)-prop-1-enyl]pyrazol-4-yl]-6-methylidenepiperidin-2-one.
| Compound Name | ethane;3-[1-ethenyl-5-[(Z)-prop-1-enyl]pyrazol-4-yl]-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 167469898 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | ethane;3-[1-ethenyl-5-[(Z)-prop-1-enyl]pyrazol-4-yl]-6-methylidenepiperidin-2-one |
| SMILES | C=Cn1ncc(C2CCC(=C)NC2=O)c1/C=C\C.CC |
| InChI | InChI=1S/C14H17N3O.C2H6/c1-4-6-13-12(9-15-17(13)5-2)11-8-7-10(3)16-14(11)18;1-2/h4-6,9,11H,2-3,7-8H2,1H3,(H,16,18);1-2H3/b6-4-; |
| InChIKey | QRUHHUSSXBZTCD-YHSAGPEESA-N |
| XLogP | 3.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |