C21H26N4O4 — CID 167470207
4-[4-[(5-formamido-5-oxopentan-2-yl)-methylamino]-3-(methylamino)anilino]benzoic acid (PubChem CID 167470207) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[4-[(5-formamido-5-oxopentan-2-yl)-methylamino]-3-(methylamino)anilino]benzoic acid.
| Compound Name | 4-[4-[(5-formamido-5-oxopentan-2-yl)-methylamino]-3-(methylamino)anilino]benzoic acid |
|---|---|
| PubChem CID | 167470207 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-[4-[(5-formamido-5-oxopentan-2-yl)-methylamino]-3-(methylamino)anilino]benzoic acid |
| SMILES | CNc1cc(Nc2ccc(C(=O)O)cc2)ccc1N(C)C(C)CCC(=O)NC=O |
| InChI | InChI=1S/C21H26N4O4/c1-14(4-11-20(27)23-13-26)25(3)19-10-9-17(12-18(19)22-2)24-16-7-5-15(6-8-16)21(28)29/h5-10,12-14,22,24H,4,11H2,1-3H3,(H,28,29)(H,23,26,27) |
| InChIKey | NGEGOKPGMGDHPK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|