About 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane
5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane (PubChem CID 167470272) has the molecular formula C12H21BrN2
and a molecular weight of 273.22 g/mol. Its IUPAC name is 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane.
Molecular Properties
| Compound Name | 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane |
| PubChem CID | 167470272 |
| Molecular Formula | C12H21BrN2 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane |
| SMILES | CC.CC(C)=C1C=CC(Br)=CN1N(C)C |
| InChI | InChI=1S/C10H15BrN2.C2H6/c1-8(2)10-6-5-9(11)7-13(10)12(3)4;1-2/h5-7H,1-4H3;1-2H3 |
| InChIKey | OLYGVRVVTQJRIR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane?
The IUPAC name of 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane (CID 167470272) is 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane.
What is the SMILES notation for 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane?
The canonical SMILES for 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane is CC.CC(C)=C1C=CC(Br)=CN1N(C)C.
What is the InChIKey of 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane?
The InChIKey is OLYGVRVVTQJRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrN2.C2H6/c1-8(2)10-6-5-9(11)7-13(10)12(3)4;1-2/h5-7H,1-4H3;1-2H3.
What are the key properties of 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane?
5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane has a molecular weight of 273.22 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,N-dimethyl-2-propan-2-ylidenepyridin-1-amine;ethane is sourced from PubChem (CID 167470272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).