About (2R)-2,5-bis(ethenoxymethyl)oxolane
(2R)-2,5-bis(ethenoxymethyl)oxolane (PubChem CID 167472769) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is (2R)-2,5-bis(ethenoxymethyl)oxolane.
Molecular Properties
| Compound Name | (2R)-2,5-bis(ethenoxymethyl)oxolane |
| PubChem CID | 167472769 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2R)-2,5-bis(ethenoxymethyl)oxolane |
| SMILES | C=COCC1CC[C@H](COC=C)O1 |
| InChI | InChI=1S/C10H16O3/c1-3-11-7-9-5-6-10(13-9)8-12-4-2/h3-4,9-10H,1-2,5-8H2/t9-,10?/m1/s1 |
| InChIKey | PJLAAGCWQVQRGK-YHMJZVADSA-N |
| XLogP | 1.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,5-bis(ethenoxymethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,5-bis(ethenoxymethyl)oxolane?
The IUPAC name of (2R)-2,5-bis(ethenoxymethyl)oxolane (CID 167472769) is (2R)-2,5-bis(ethenoxymethyl)oxolane.
What is the SMILES notation for (2R)-2,5-bis(ethenoxymethyl)oxolane?
The canonical SMILES for (2R)-2,5-bis(ethenoxymethyl)oxolane is C=COCC1CC[C@H](COC=C)O1.
What is the InChIKey of (2R)-2,5-bis(ethenoxymethyl)oxolane?
The InChIKey is PJLAAGCWQVQRGK-YHMJZVADSA-N. The full InChI is InChI=1S/C10H16O3/c1-3-11-7-9-5-6-10(13-9)8-12-4-2/h3-4,9-10H,1-2,5-8H2/t9-,10?/m1/s1.
What are the key properties of (2R)-2,5-bis(ethenoxymethyl)oxolane?
(2R)-2,5-bis(ethenoxymethyl)oxolane has a molecular weight of 184.23 g/mol, XLogP of 1.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,5-bis(ethenoxymethyl)oxolane is sourced from PubChem (CID 167472769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).