C23H28N2O5 — CID 167473189
2-[(2R,4R)-2-(hydroxymethyl)-4-[[2-(2-methoxyphenyl)furo[3,2-b]pyridin-7-yl]amino]cyclopentyl]oxypropan-2-ol (PubChem CID 167473189) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[(2R,4R)-2-(hydroxymethyl)-4-[[2-(2-methoxyphenyl)furo[3,2-b]pyridin-7-yl]amino]cyclopentyl]oxypropan-2-ol.
| Compound Name | 2-[(2R,4R)-2-(hydroxymethyl)-4-[[2-(2-methoxyphenyl)furo[3,2-b]pyridin-7-yl]amino]cyclopentyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 167473189 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[(2R,4R)-2-(hydroxymethyl)-4-[[2-(2-methoxyphenyl)furo[3,2-b]pyridin-7-yl]amino]cyclopentyl]oxypropan-2-ol |
| SMILES | COc1ccccc1-c1cc2nccc(N[C@H]3CC(OC(C)(C)O)[C@@H](CO)C3)c2o1 |
| InChI | InChI=1S/C23H28N2O5/c1-23(2,27)30-20-11-15(10-14(20)13-26)25-17-8-9-24-18-12-21(29-22(17)18)16-6-4-5-7-19(16)28-3/h4-9,12,14-15,20,26-27H,10-11,13H2,1-3H3,(H,24,25)/t14-,15-,20?/m1/s1 |
| InChIKey | MHJZYWLNKHGGNP-YNCRUDOASA-N |
| XLogP | 3.80 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|