C22H43O8P — CID 16747450
(1-nonanoyloxy-3-phosphonooxypropan-2-yl) decanoate (PubChem CID 16747450) has the molecular formula C22H43O8P and a molecular weight of 466.55 g/mol. Its IUPAC name is (1-nonanoyloxy-3-phosphonooxypropan-2-yl) decanoate.
| Compound Name | (1-nonanoyloxy-3-phosphonooxypropan-2-yl) decanoate |
|---|---|
| PubChem CID | 16747450 |
| Molecular Formula | C22H43O8P |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (1-nonanoyloxy-3-phosphonooxypropan-2-yl) decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C22H43O8P/c1-3-5-7-9-11-13-15-17-22(24)30-20(19-29-31(25,26)27)18-28-21(23)16-14-12-10-8-6-4-2/h20H,3-19H2,1-2H3,(H2,25,26,27) |
| InChIKey | VELFGIGJKOKBJN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|