About ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine
ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine (PubChem CID 167474863) has the molecular formula C16H34N4
and a molecular weight of 282.48 g/mol. Its IUPAC name is ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine |
| PubChem CID | 167474863 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine |
| SMILES | CC.CNN1CCC(CN2C3CCC2CN(C)C3)CC1 |
| InChI | InChI=1S/C14H28N4.C2H6/c1-15-17-7-5-12(6-8-17)9-18-13-3-4-14(18)11-16(2)10-13;1-2/h12-15H,3-11H2,1-2H3;1-2H3 |
| InChIKey | HNWDZMACOCAAQL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine?
The IUPAC name of ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine (CID 167474863) is ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine.
What is the SMILES notation for ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine?
The canonical SMILES for ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine is CC.CNN1CCC(CN2C3CCC2CN(C)C3)CC1.
What is the InChIKey of ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine?
The InChIKey is HNWDZMACOCAAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4.C2H6/c1-15-17-7-5-12(6-8-17)9-18-13-3-4-14(18)11-16(2)10-13;1-2/h12-15H,3-11H2,1-2H3;1-2H3.
What are the key properties of ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine?
ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine has a molecular weight of 282.48 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-4-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]piperidin-1-amine is sourced from PubChem (CID 167474863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).