About 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid
4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid (PubChem CID 167475365) has the molecular formula C17H10F4N2O5S2
and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid.
Molecular Properties
| Compound Name | 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid |
| PubChem CID | 167475365 |
| Molecular Formula | C17H10F4N2O5S2 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cnc(-c3ccc(F)cc3)s2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F4N2O5S2/c18-11-4-1-9(2-5-11)15-22-8-14(29-15)30(26,27)23-12-6-3-10(16(24)25)7-13(12)28-17(19,20)21/h1-8,23H,(H,24,25) |
| InChIKey | XXQQOHNFCLDNSJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid?
The IUPAC name of 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid (CID 167475365) is 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid.
What is the SMILES notation for 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid?
The canonical SMILES for 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid is O=C(O)c1ccc(NS(=O)(=O)c2cnc(-c3ccc(F)cc3)s2)c(OC(F)(F)F)c1.
What is the InChIKey of 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid?
The InChIKey is XXQQOHNFCLDNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F4N2O5S2/c18-11-4-1-9(2-5-11)15-22-8-14(29-15)30(26,27)23-12-6-3-10(16(24)25)7-13(12)28-17(19,20)21/h1-8,23H,(H,24,25).
What are the key properties of 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid?
4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid has a molecular weight of 462.40 g/mol, XLogP of 4.35, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]-3-(trifluoromethoxy)benzoic acid is sourced from PubChem (CID 167475365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).