About 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid
6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 167475464) has the molecular formula C15H10FN3O4S2
and a molecular weight of 379.39 g/mol. Its IUPAC name is 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid |
| PubChem CID | 167475464 |
| Molecular Formula | C15H10FN3O4S2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cnc(-c3ccc(F)cc3)s2)nc1 |
| InChI | InChI=1S/C15H10FN3O4S2/c16-11-4-1-9(2-5-11)14-18-8-13(24-14)25(22,23)19-12-6-3-10(7-17-12)15(20)21/h1-8H,(H,17,19)(H,20,21) |
| InChIKey | ZJMWXBCMOGWIOM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid (CID 167475464) is 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid is O=C(O)c1ccc(NS(=O)(=O)c2cnc(-c3ccc(F)cc3)s2)nc1.
What is the InChIKey of 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid?
The InChIKey is ZJMWXBCMOGWIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN3O4S2/c16-11-4-1-9(2-5-11)14-18-8-13(24-14)25(22,23)19-12-6-3-10(7-17-12)15(20)21/h1-8H,(H,17,19)(H,20,21).
What are the key properties of 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid?
6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid has a molecular weight of 379.39 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfonylamino]pyridine-3-carboxylic acid is sourced from PubChem (CID 167475464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).