About 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate
3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 16747563) has the molecular formula C25H27FN4O4
and a molecular weight of 466.51 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
Molecular Properties
| Compound Name | 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| PubChem CID | 16747563 |
| Molecular Formula | C25H27FN4O4 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | O=C(Nc1cccc(Cn2nc(-c3ccc(F)cc3)ccc2=O)c1)OCCCN1CCOCC1 |
| InChI | InChI=1S/C25H27FN4O4/c26-21-7-5-20(6-8-21)23-9-10-24(31)30(28-23)18-19-3-1-4-22(17-19)27-25(32)34-14-2-11-29-12-15-33-16-13-29/h1,3-10,17H,2,11-16,18H2,(H,27,32) |
| InChIKey | SDACLXYBPKVPIJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate?
The IUPAC name of 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (CID 16747563) is 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
What is the SMILES notation for 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate?
The canonical SMILES for 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate is O=C(Nc1cccc(Cn2nc(-c3ccc(F)cc3)ccc2=O)c1)OCCCN1CCOCC1.
What is the InChIKey of 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate?
The InChIKey is SDACLXYBPKVPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27FN4O4/c26-21-7-5-20(6-8-21)23-9-10-24(31)30(28-23)18-19-3-1-4-22(17-19)27-25(32)34-14-2-11-29-12-15-33-16-13-29/h1,3-10,17H,2,11-16,18H2,(H,27,32).
What are the key properties of 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate?
3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate has a molecular weight of 466.51 g/mol, XLogP of 3.37, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-ylpropyl N-[3-[[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate is sourced from PubChem (CID 16747563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).