C18H29FO — CID 167475670
4-[(2Z,4Z)-4-ethoxy-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1,1-dimethylcyclohexane (PubChem CID 167475670) has the molecular formula C18H29FO and a molecular weight of 280.43 g/mol. Its IUPAC name is 4-[(2Z,4Z)-4-ethoxy-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1,1-dimethylcyclohexane.
| Compound Name | 4-[(2Z,4Z)-4-ethoxy-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1,1-dimethylcyclohexane |
|---|---|
| PubChem CID | 167475670 |
| Molecular Formula | C18H29FO |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 4-[(2Z,4Z)-4-ethoxy-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1,1-dimethylcyclohexane |
| SMILES | C=C(C)/C(F)=C(OCC)\C(=C/C)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H29FO/c1-7-15(14-9-11-18(5,6)12-10-14)17(20-8-2)16(19)13(3)4/h7,14H,3,8-12H2,1-2,4-6H3/b15-7-,17-16- |
| InChIKey | UJTOHMPAXVXSKN-JUTYAXIQSA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|