C21H35FO — CID 167476686
1-tert-butyl-4-[(2Z,4Z)-5-fluoro-6-methyl-4-propan-2-yloxyhepta-2,4,6-trien-3-yl]cyclohexane (PubChem CID 167476686) has the molecular formula C21H35FO and a molecular weight of 322.51 g/mol. Its IUPAC name is 1-tert-butyl-4-[(2Z,4Z)-5-fluoro-6-methyl-4-propan-2-yloxyhepta-2,4,6-trien-3-yl]cyclohexane.
| Compound Name | 1-tert-butyl-4-[(2Z,4Z)-5-fluoro-6-methyl-4-propan-2-yloxyhepta-2,4,6-trien-3-yl]cyclohexane |
|---|---|
| PubChem CID | 167476686 |
| Molecular Formula | C21H35FO |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-tert-butyl-4-[(2Z,4Z)-5-fluoro-6-methyl-4-propan-2-yloxyhepta-2,4,6-trien-3-yl]cyclohexane |
| SMILES | C=C(C)/C(F)=C(OC(C)C)\C(=C/C)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H35FO/c1-9-18(20(23-15(4)5)19(22)14(2)3)16-10-12-17(13-11-16)21(6,7)8/h9,15-17H,2,10-13H2,1,3-8H3/b18-9-,20-19- |
| InChIKey | KOXMFKAINQJVQD-HJSCIRPVSA-N |
| XLogP | 6.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|