C16H21I2N3S — CID 16747676
3-N,3-N,7-N,7-N-tetramethyl-10H-phenothiazine-3,7-diamine;dihydroiodide (PubChem CID 16747676) has the molecular formula C16H21I2N3S and a molecular weight of 541.24 g/mol. Its IUPAC name is 3-N,3-N,7-N,7-N-tetramethyl-10H-phenothiazine-3,7-diamine;dihydroiodide.
| Compound Name | 3-N,3-N,7-N,7-N-tetramethyl-10H-phenothiazine-3,7-diamine;dihydroiodide |
|---|---|
| PubChem CID | 16747676 |
| Molecular Formula | C16H21I2N3S |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 540.95 |
| IUPAC Name | 3-N,3-N,7-N,7-N-tetramethyl-10H-phenothiazine-3,7-diamine;dihydroiodide |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2.I.I |
| InChI | InChI=1S/C16H19N3S.2HI/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;/h5-10,17H,1-4H3;2*1H |
| InChIKey | BDAGHZCIEPYMGY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|