C14H23ClOSi — CID 16747685
[(2S,3S,6R)-6-but-3-ynyl-4-chloro-2,3-dimethyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane (PubChem CID 16747685) has the molecular formula C14H23ClOSi and a molecular weight of 270.88 g/mol. Its IUPAC name is [(2S,3S,6R)-6-but-3-ynyl-4-chloro-2,3-dimethyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane.
| Compound Name | [(2S,3S,6R)-6-but-3-ynyl-4-chloro-2,3-dimethyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 16747685 |
| Molecular Formula | C14H23ClOSi |
| Molecular Weight | 270.88 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(2S,3S,6R)-6-but-3-ynyl-4-chloro-2,3-dimethyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
| SMILES | C#CCC[C@H]1O[C@@H](C)[C@H](C)C(Cl)=C1[Si](C)(C)C |
| InChI | InChI=1S/C14H23ClOSi/c1-7-8-9-12-14(17(4,5)6)13(15)10(2)11(3)16-12/h1,10-12H,8-9H2,2-6H3/t10-,11-,12+/m0/s1 |
| InChIKey | XUMJCDKNHUNFGE-SDDRHHMPSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|