C22H13Cl2F2N5O3 — CID 167477287
2-[3,5-dichloro-4-[(5,8-difluoro-1-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477287) has the molecular formula C22H13Cl2F2N5O3 and a molecular weight of 504.28 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(5,8-difluoro-1-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[(5,8-difluoro-1-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477287 |
| Molecular Formula | C22H13Cl2F2N5O3 |
| Molecular Weight | 504.28 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | 2-[3,5-dichloro-4-[(5,8-difluoro-1-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CC1CCc2[nH]c3c(F)cc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)c(F)c3c21 |
| InChI | InChI=1S/C22H13Cl2F2N5O3/c1-8-2-3-13-16(8)17-18(26)15(6-12(25)19(17)28-13)34-20-10(23)4-9(5-11(20)24)31-22(33)29-21(32)14(7-27)30-31/h4-6,8,28H,2-3H2,1H3,(H,29,32,33) |
| InChIKey | IEICGMYPYKBCJN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |