C24H16Cl2F3N5O4 — CID 167477311
2-[3,5-dichloro-4-[[5-(difluoromethyl)-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477311) has the molecular formula C24H16Cl2F3N5O4 and a molecular weight of 566.32 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[5-(difluoromethyl)-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[5-(difluoromethyl)-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477311 |
| Molecular Formula | C24H16Cl2F3N5O4 |
| Molecular Weight | 566.32 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | 2-[3,5-dichloro-4-[[5-(difluoromethyl)-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CC1(C)COCc2[nH]c3c(F)cc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)c(C(F)F)c3c21 |
| InChI | InChI=1S/C24H16Cl2F3N5O4/c1-24(2)8-37-7-14-18(24)17-16(21(28)29)15(5-12(27)19(17)31-14)38-20-10(25)3-9(4-11(20)26)34-23(36)32-22(35)13(6-30)33-34/h3-5,21,31H,7-8H2,1-2H3,(H,32,35,36) |
| InChIKey | NVCAVPXHTCAMTM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |