C24H17Cl2F3N6O3 — CID 167477317
2-[3,5-dichloro-4-[[4,4-dimethyl-1-(trifluoromethyl)-1,2,3,9-tetrahydropyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477317) has the molecular formula C24H17Cl2F3N6O3 and a molecular weight of 565.34 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[4,4-dimethyl-1-(trifluoromethyl)-1,2,3,9-tetrahydropyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[4,4-dimethyl-1-(trifluoromethyl)-1,2,3,9-tetrahydropyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477317 |
| Molecular Formula | C24H17Cl2F3N6O3 |
| Molecular Weight | 565.34 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 2-[3,5-dichloro-4-[[4,4-dimethyl-1-(trifluoromethyl)-1,2,3,9-tetrahydropyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CC1(C)CNC(C(F)(F)F)c2[nH]c3ccc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)cc3c21 |
| InChI | InChI=1S/C24H17Cl2F3N6O3/c1-23(2)9-31-20(24(27,28)29)18-17(23)12-7-11(3-4-15(12)32-18)38-19-13(25)5-10(6-14(19)26)35-22(37)33-21(36)16(8-30)34-35/h3-7,20,31-32H,9H2,1-2H3,(H,33,36,37) |
| InChIKey | DSSVGLXUUFVTJI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |