C24H15Cl2F2N5O4 — CID 167477331
2-[3,5-dichloro-4-(1',1'-difluorospiro[3,9-dihydro-1H-pyrano[3,4-b]indole-4,3'-cyclobutane]-6-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477331) has the molecular formula C24H15Cl2F2N5O4 and a molecular weight of 546.32 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(1',1'-difluorospiro[3,9-dihydro-1H-pyrano[3,4-b]indole-4,3'-cyclobutane]-6-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-(1',1'-difluorospiro[3,9-dihydro-1H-pyrano[3,4-b]indole-4,3'-cyclobutane]-6-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477331 |
| Molecular Formula | C24H15Cl2F2N5O4 |
| Molecular Weight | 546.32 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 2-[3,5-dichloro-4-(1',1'-difluorospiro[3,9-dihydro-1H-pyrano[3,4-b]indole-4,3'-cyclobutane]-6-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3ccc4[nH]c5c(c4c3)C3(COC5)CC(F)(F)C3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H15Cl2F2N5O4/c25-14-3-11(33-22(35)31-21(34)17(6-29)32-33)4-15(26)20(14)37-12-1-2-16-13(5-12)19-18(30-16)7-36-10-23(19)8-24(27,28)9-23/h1-5,30H,7-10H2,(H,31,34,35) |
| InChIKey | DHYCWWFTXVPKPH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |