C23H15F4N5O4 — CID 167477336
2-[4-[(7,8-difluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]-3,5-difluorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477336) has the molecular formula C23H15F4N5O4 and a molecular weight of 501.40 g/mol. Its IUPAC name is 2-[4-[(7,8-difluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]-3,5-difluorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[4-[(7,8-difluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]-3,5-difluorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477336 |
| Molecular Formula | C23H15F4N5O4 |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[4-[(7,8-difluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]-3,5-difluorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CC1(C)COCc2[nH]c3c(F)c(F)c(Oc4c(F)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4F)cc3c21 |
| InChI | InChI=1S/C23H15F4N5O4/c1-23(2)8-35-7-14-16(23)10-5-15(17(26)18(27)19(10)29-14)36-20-11(24)3-9(4-12(20)25)32-22(34)30-21(33)13(6-28)31-32/h3-5,29H,7-8H2,1-2H3,(H,30,33,34) |
| InChIKey | WMKBKEMWRJOHOK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |