C25H19Cl2F3N6O3 — CID 167477405
2-[3,5-dichloro-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477405) has the molecular formula C25H19Cl2F3N6O3 and a molecular weight of 579.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477405 |
| Molecular Formula | C25H19Cl2F3N6O3 |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 2-[3,5-dichloro-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CC1(C)CNC(C)(C(F)(F)F)c2[nH]c3ccc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)cc3c21 |
| InChI | InChI=1S/C25H19Cl2F3N6O3/c1-23(2)10-32-24(3,25(28,29)30)20-18(23)13-8-12(4-5-16(13)33-20)39-19-14(26)6-11(7-15(19)27)36-22(38)34-21(37)17(9-31)35-36/h4-8,32-33H,10H2,1-3H3,(H,34,37,38) |
| InChIKey | VKACKSVLGDIXHO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |