C16H13NO2 — CID 16747761
5,5-dimethyl-6,11-dioxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,8,12(17),13,15-heptaene (PubChem CID 16747761) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5,5-dimethyl-6,11-dioxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,8,12(17),13,15-heptaene.
| Compound Name | 5,5-dimethyl-6,11-dioxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,8,12(17),13,15-heptaene |
|---|---|
| PubChem CID | 16747761 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5,5-dimethyl-6,11-dioxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,8,12(17),13,15-heptaene |
| SMILES | CC1(C)C=Cc2c(ccc3oc4ccncc4c23)O1 |
| InChI | InChI=1S/C16H13NO2/c1-16(2)7-5-10-13(19-16)3-4-14-15(10)11-9-17-8-6-12(11)18-14/h3-9H,1-2H3 |
| InChIKey | XQNKCNMRGMUKKH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |