C16H20N4O4 — CID 167478438
1-[4-(2-oxo-2-piperazin-1-ylethoxy)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 167478438) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[4-(2-oxo-2-piperazin-1-ylethoxy)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-(2-oxo-2-piperazin-1-ylethoxy)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167478438 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[4-(2-oxo-2-piperazin-1-ylethoxy)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc(OCC(=O)N3CCNCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H20N4O4/c21-14-5-8-20(16(23)18-14)12-1-3-13(4-2-12)24-11-15(22)19-9-6-17-7-10-19/h1-4,17H,5-11H2,(H,18,21,23) |
| InChIKey | CZDXJUPEYVDMFW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |