About ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one
ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one (PubChem CID 167479305) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one |
| PubChem CID | 167479305 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one |
| SMILES | C=CC1=C(/N=C/C)CNC1=O.CC.CC |
| InChI | InChI=1S/C8H10N2O.2C2H6/c1-3-6-7(9-4-2)5-10-8(6)11;2*1-2/h3-4H,1,5H2,2H3,(H,10,11);2*1-2H3/b9-4+;; |
| InChIKey | UYVNYXCBUXYANL-HPJBNNNXSA-N |
| XLogP | 2.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one?
The IUPAC name of ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one (CID 167479305) is ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one?
The canonical SMILES for ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one is C=CC1=C(/N=C/C)CNC1=O.CC.CC.
What is the InChIKey of ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one?
The InChIKey is UYVNYXCBUXYANL-HPJBNNNXSA-N. The full InChI is InChI=1S/C8H10N2O.2C2H6/c1-3-6-7(9-4-2)5-10-8(6)11;2*1-2/h3-4H,1,5H2,2H3,(H,10,11);2*1-2H3/b9-4+;;.
What are the key properties of ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one?
ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one has a molecular weight of 210.32 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 167479305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).