C29H36N6O3 — CID 167479991
3-(4-phenoxyphenyl)-1-[1-[2-(2-propoxyethoxy)ethyl]piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 167479991) has the molecular formula C29H36N6O3 and a molecular weight of 516.65 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[1-[2-(2-propoxyethoxy)ethyl]piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-phenoxyphenyl)-1-[1-[2-(2-propoxyethoxy)ethyl]piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167479991 |
| Molecular Formula | C29H36N6O3 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[1-[2-(2-propoxyethoxy)ethyl]piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCOCCOCCN1CCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C29H36N6O3/c1-2-17-36-19-20-37-18-16-34-14-12-23(13-15-34)35-29-26(28(30)31-21-32-29)27(33-35)22-8-10-25(11-9-22)38-24-6-4-3-5-7-24/h3-11,21,23H,2,12-20H2,1H3,(H2,30,31,32) |
| InChIKey | OTEPFXUIWVINLJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|