C39H19BF24N2 — CID 16748038
1H-pyrrolo[2,3-b]pyridin-7-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 16748038) has the molecular formula C39H19BF24N2 and a molecular weight of 982.36 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridin-7-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | 1H-pyrrolo[2,3-b]pyridin-7-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 16748038 |
| Molecular Formula | C39H19BF24N2 |
| Molecular Weight | 982.36 g/mol |
| Exact Mass | 982.13 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridin-7-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.c1c[nH+]c2[nH]ccc2c1 |
| InChI | InChI=1S/C32H12BF24.C7H6N2/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-2-6-3-5-9-7(6)8-4-1/h1-12H;1-5H,(H,8,9)/q-1;/p+1 |
| InChIKey | XDUSVADWYJEWKO-UHFFFAOYSA-O |
| XLogP | 12.20 |
| TPSA | 29.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.36 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|