About 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol
2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol (PubChem CID 167480859) has the molecular formula C22H30F2N2S
and a molecular weight of 392.56 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol.
Molecular Properties
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol |
| PubChem CID | 167480859 |
| Molecular Formula | C22H30F2N2S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol |
| SMILES | C=C.CN1CCC(N)CC1C(c1ccc(F)cc1)c1ccc(F)cc1.CS |
| InChI | InChI=1S/C19H22F2N2.C2H4.CH4S/c1-23-11-10-17(22)12-18(23)19(13-2-6-15(20)7-3-13)14-4-8-16(21)9-5-14;2*1-2/h2-9,17-19H,10-12,22H2,1H3;1-2H2;2H,1H3 |
| InChIKey | VFCQMRHMHIMDPM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol?
The IUPAC name of 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol (CID 167480859) is 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol.
What is the SMILES notation for 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol?
The canonical SMILES for 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol is C=C.CN1CCC(N)CC1C(c1ccc(F)cc1)c1ccc(F)cc1.CS.
What is the InChIKey of 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol?
The InChIKey is VFCQMRHMHIMDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N2.C2H4.CH4S/c1-23-11-10-17(22)12-18(23)19(13-2-6-15(20)7-3-13)14-4-8-16(21)9-5-14;2*1-2/h2-9,17-19H,10-12,22H2,1H3;1-2H2;2H,1H3.
What are the key properties of 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol?
2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol has a molecular weight of 392.56 g/mol, XLogP of 4.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(4-fluorophenyl)methyl]-1-methylpiperidin-4-amine;ethene;methanethiol is sourced from PubChem (CID 167480859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).