About 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol
2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol (PubChem CID 167480861) has the molecular formula C20H22F2OS
and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol.
Molecular Properties
| Compound Name | 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol |
| PubChem CID | 167480861 |
| Molecular Formula | C20H22F2OS |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol |
| SMILES | C=CS.Fc1ccc(C(c2ccc(F)cc2)C2CCCCO2)cc1 |
| InChI | InChI=1S/C18H18F2O.C2H4S/c19-15-8-4-13(5-9-15)18(17-3-1-2-12-21-17)14-6-10-16(20)11-7-14;1-2-3/h4-11,17-18H,1-3,12H2;2-3H,1H2 |
| InChIKey | VOJMBAVWDCAYMM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol?
The IUPAC name of 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol (CID 167480861) is 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol.
What is the SMILES notation for 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol?
The canonical SMILES for 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol is C=CS.Fc1ccc(C(c2ccc(F)cc2)C2CCCCO2)cc1.
What is the InChIKey of 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol?
The InChIKey is VOJMBAVWDCAYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2O.C2H4S/c19-15-8-4-13(5-9-15)18(17-3-1-2-12-21-17)14-6-10-16(20)11-7-14;1-2-3/h4-11,17-18H,1-3,12H2;2-3H,1H2.
What are the key properties of 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol?
2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol has a molecular weight of 348.46 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(4-fluorophenyl)methyl]oxane;ethenethiol is sourced from PubChem (CID 167480861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).