About [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate
[1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate (PubChem CID 167480973) has the molecular formula C14H19F3N2O3
and a molecular weight of 320.31 g/mol. Its IUPAC name is [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate.
Molecular Properties
| Compound Name | [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate |
| PubChem CID | 167480973 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate |
| SMILES | CC1(C)C2CN(C(=O)CNC(=O)OC3(C(F)(F)F)CC3)CC21 |
| InChI | InChI=1S/C14H19F3N2O3/c1-12(2)8-6-19(7-9(8)12)10(20)5-18-11(21)22-13(3-4-13)14(15,16)17/h8-9H,3-7H2,1-2H3,(H,18,21) |
| InChIKey | LWOGLEHZJWXPQB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate?
The IUPAC name of [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate (CID 167480973) is [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate.
What is the SMILES notation for [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate?
The canonical SMILES for [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate is CC1(C)C2CN(C(=O)CNC(=O)OC3(C(F)(F)F)CC3)CC21.
What is the InChIKey of [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate?
The InChIKey is LWOGLEHZJWXPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O3/c1-12(2)8-6-19(7-9(8)12)10(20)5-18-11(21)22-13(3-4-13)14(15,16)17/h8-9H,3-7H2,1-2H3,(H,18,21).
What are the key properties of [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate?
[1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate has a molecular weight of 320.31 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(trifluoromethyl)cyclopropyl] N-[2-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-2-oxoethyl]carbamate is sourced from PubChem (CID 167480973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).