C25H36F5N5O5 — CID 167481164
N-[1-cyano-2-(5-oxo-4-azaspiro[2.4]heptan-6-yl)ethyl]formamide;(3R)-3-(difluoromethoxy)-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167481164) has the molecular formula C25H36F5N5O5 and a molecular weight of 581.58 g/mol. Its IUPAC name is N-[1-cyano-2-(5-oxo-4-azaspiro[2.4]heptan-6-yl)ethyl]formamide;(3R)-3-(difluoromethoxy)-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | N-[1-cyano-2-(5-oxo-4-azaspiro[2.4]heptan-6-yl)ethyl]formamide;(3R)-3-(difluoromethoxy)-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167481164 |
| Molecular Formula | C25H36F5N5O5 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | N-[1-cyano-2-(5-oxo-4-azaspiro[2.4]heptan-6-yl)ethyl]formamide;(3R)-3-(difluoromethoxy)-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;2,2,2-trifluoroacetamide |
| SMILES | C[C@H](CC(=O)N1CC2C([C@H]1C)C2(C)C)OC(F)F.N#CC(CC1CC2(CC2)NC1=O)NC=O.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H21F2NO2.C10H13N3O2.C2H2F3NO/c1-7(18-12(14)15)5-10(17)16-6-9-11(8(16)2)13(9,3)4;11-5-8(12-6-14)3-7-4-10(1-2-10)13-9(7)15;3-2(4,5)1(6)7/h7-9,11-12H,5-6H2,1-4H3;6-8H,1-4H2,(H,12,14)(H,13,15);(H2,6,7)/t7-,8-,9?,11?;;/m1../s1 |
| InChIKey | PQGJRGNZBCOJQA-XUTBHKECSA-N |
| XLogP | 2.22 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|