C18H25F3N2O5 — CID 167481521
(1R,2S,5S)-3-[(2S,3R)-3-cyclobutyloxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 167481521) has the molecular formula C18H25F3N2O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (1R,2S,5S)-3-[(2S,3R)-3-cyclobutyloxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,2S,5S)-3-[(2S,3R)-3-cyclobutyloxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 167481521 |
| Molecular Formula | C18H25F3N2O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (1R,2S,5S)-3-[(2S,3R)-3-cyclobutyloxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | C[C@@H](OC1CCC1)[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)O)C2(C)C |
| InChI | InChI=1S/C18H25F3N2O5/c1-8(28-9-5-4-6-9)12(22-16(27)18(19,20)21)14(24)23-7-10-11(17(10,2)3)13(23)15(25)26/h8-13H,4-7H2,1-3H3,(H,22,27)(H,25,26)/t8-,10+,11+,12+,13+/m1/s1 |
| InChIKey | GWOFCWXSZOJEHT-QFEZGCEISA-N |
| XLogP | 1.56 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |