C21H36F5N3O4 — CID 167481652
(3R)-3-(3,3-difluorocyclobutyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;N-propan-2-ylformamide;2,2,2-trifluoroacetamide (PubChem CID 167481652) has the molecular formula C21H36F5N3O4 and a molecular weight of 489.53 g/mol. Its IUPAC name is (3R)-3-(3,3-difluorocyclobutyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;N-propan-2-ylformamide;2,2,2-trifluoroacetamide.
| Compound Name | (3R)-3-(3,3-difluorocyclobutyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;N-propan-2-ylformamide;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167481652 |
| Molecular Formula | C21H36F5N3O4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | (3R)-3-(3,3-difluorocyclobutyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;N-propan-2-ylformamide;2,2,2-trifluoroacetamide |
| SMILES | CC(C)NC=O.CC1CN(C(=O)C[C@@H](C)OC2CC(F)(F)C2)CC1(C)C.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H25F2NO2.C4H9NO.C2H2F3NO/c1-10-8-18(9-14(10,3)4)13(19)5-11(2)20-12-6-15(16,17)7-12;1-4(2)5-3-6;3-2(4,5)1(6)7/h10-12H,5-9H2,1-4H3;3-4H,1-2H3,(H,5,6);(H2,6,7)/t10?,11-;;/m1../s1 |
| InChIKey | WFPSTALOWKQTLX-YIYGWLNYSA-N |
| XLogP | 3.26 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|