About 2-amino-3-(1,2-oxazolidin-4-yl)propanal
2-amino-3-(1,2-oxazolidin-4-yl)propanal (PubChem CID 167481885) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-amino-3-(1,2-oxazolidin-4-yl)propanal.
Molecular Properties
| Compound Name | 2-amino-3-(1,2-oxazolidin-4-yl)propanal |
| PubChem CID | 167481885 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-amino-3-(1,2-oxazolidin-4-yl)propanal |
| SMILES | NC(C=O)CC1CNOC1 |
| InChI | InChI=1S/C6H12N2O2/c7-6(3-9)1-5-2-8-10-4-5/h3,5-6,8H,1-2,4,7H2 |
| InChIKey | VCWLTHBZPFXYAU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(1,2-oxazolidin-4-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(1,2-oxazolidin-4-yl)propanal?
The IUPAC name of 2-amino-3-(1,2-oxazolidin-4-yl)propanal (CID 167481885) is 2-amino-3-(1,2-oxazolidin-4-yl)propanal.
What is the SMILES notation for 2-amino-3-(1,2-oxazolidin-4-yl)propanal?
The canonical SMILES for 2-amino-3-(1,2-oxazolidin-4-yl)propanal is NC(C=O)CC1CNOC1.
What is the InChIKey of 2-amino-3-(1,2-oxazolidin-4-yl)propanal?
The InChIKey is VCWLTHBZPFXYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c7-6(3-9)1-5-2-8-10-4-5/h3,5-6,8H,1-2,4,7H2.
What are the key properties of 2-amino-3-(1,2-oxazolidin-4-yl)propanal?
2-amino-3-(1,2-oxazolidin-4-yl)propanal has a molecular weight of 144.17 g/mol, XLogP of -0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,2-oxazolidin-4-yl)propanal is sourced from PubChem (CID 167481885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).