C28H46F2N4O6 — CID 167481891
acetaldehyde;(3R)-3-(3,3-difluorocyclobutyl)oxy-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-2-formamidopropanamide (PubChem CID 167481891) has the molecular formula C28H46F2N4O6 and a molecular weight of 572.69 g/mol. Its IUPAC name is acetaldehyde;(3R)-3-(3,3-difluorocyclobutyl)oxy-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-2-formamidopropanamide.
| Compound Name | acetaldehyde;(3R)-3-(3,3-difluorocyclobutyl)oxy-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-2-formamidopropanamide |
|---|---|
| PubChem CID | 167481891 |
| Molecular Formula | C28H46F2N4O6 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | acetaldehyde;(3R)-3-(3,3-difluorocyclobutyl)oxy-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one;3-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-2-formamidopropanamide |
| SMILES | CC1(C)CC(CC(NC=O)C(N)=O)C(=O)N1.CC=O.C[C@H](CC(=O)N1CC2C([C@H]1C)C2(C)C)OC1CC(F)(F)C1 |
| InChI | InChI=1S/C16H25F2NO2.C10H17N3O3.C2H4O/c1-9(21-11-6-16(17,18)7-11)5-13(20)19-8-12-14(10(19)2)15(12,3)4;1-10(2)4-6(9(16)13-10)3-7(8(11)15)12-5-14;1-2-3/h9-12,14H,5-8H2,1-4H3;5-7H,3-4H2,1-2H3,(H2,11,15)(H,12,14)(H,13,16);2H,1H3/t9-,10-,12?,14?;;/m1../s1 |
| InChIKey | KGGWYQPAFMKPRP-QLYLDEPESA-N |
| XLogP | 2.18 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|